About 1-bromo-5-methylindazole
1-bromo-5-methylindazole (PubChem CID 150964557) has the molecular formula C8H7BrN2
and a molecular weight of 211.06 g/mol. Its IUPAC name is 1-bromo-5-methylindazole.
Molecular Properties
| Compound Name | 1-bromo-5-methylindazole |
| PubChem CID | 150964557 |
| Molecular Formula | C8H7BrN2 |
| Molecular Weight | 211.06 g/mol |
| Exact Mass | 209.98 |
| IUPAC Name | 1-bromo-5-methylindazole |
| SMILES | Cc1ccc2c(cnn2Br)c1 |
| InChI | InChI=1S/C8H7BrN2/c1-6-2-3-8-7(4-6)5-10-11(8)9/h2-5H,1H3 |
| InChIKey | LMUOBASWKMXYOG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.06 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-bromo-5-methylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-5-methylindazole?
The IUPAC name of 1-bromo-5-methylindazole (CID 150964557) is 1-bromo-5-methylindazole.
What is the SMILES notation for 1-bromo-5-methylindazole?
The canonical SMILES for 1-bromo-5-methylindazole is Cc1ccc2c(cnn2Br)c1.
What is the InChIKey of 1-bromo-5-methylindazole?
The InChIKey is LMUOBASWKMXYOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrN2/c1-6-2-3-8-7(4-6)5-10-11(8)9/h2-5H,1H3.
What are the key properties of 1-bromo-5-methylindazole?
1-bromo-5-methylindazole has a molecular weight of 211.06 g/mol, XLogP of 2.50, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-5-methylindazole is sourced from PubChem (CID 150964557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).