C11H9N3O2S — CID 140960375
5-(5-methylindazol-1-yl)-1-oxo-1,2-thiazol-3-one (PubChem CID 140960375) has the molecular formula C11H9N3O2S and a molecular weight of 247.28 g/mol. Its IUPAC name is 5-(5-methylindazol-1-yl)-1-oxo-1,2-thiazol-3-one.
| Compound Name | 5-(5-methylindazol-1-yl)-1-oxo-1,2-thiazol-3-one |
|---|---|
| PubChem CID | 140960375 |
| Molecular Formula | C11H9N3O2S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 5-(5-methylindazol-1-yl)-1-oxo-1,2-thiazol-3-one |
| SMILES | Cc1ccc2c(cnn2C2=CC(=O)NS2=O)c1 |
| InChI | InChI=1S/C11H9N3O2S/c1-7-2-3-9-8(4-7)6-12-14(9)11-5-10(15)13-17(11)16/h2-6H,1H3,(H,13,15) |
| InChIKey | GFQGKAXEKFNGST-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |