C13H11N3O2S — CID 140960441
5-(5-methyl-3-phenylpyrazol-1-yl)-1-oxo-1,2-thiazol-3-one (PubChem CID 140960441) has the molecular formula C13H11N3O2S and a molecular weight of 273.32 g/mol. Its IUPAC name is 5-(5-methyl-3-phenylpyrazol-1-yl)-1-oxo-1,2-thiazol-3-one.
| Compound Name | 5-(5-methyl-3-phenylpyrazol-1-yl)-1-oxo-1,2-thiazol-3-one |
|---|---|
| PubChem CID | 140960441 |
| Molecular Formula | C13H11N3O2S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 5-(5-methyl-3-phenylpyrazol-1-yl)-1-oxo-1,2-thiazol-3-one |
| SMILES | Cc1cc(-c2ccccc2)nn1C1=CC(=O)NS1=O |
| InChI | InChI=1S/C13H11N3O2S/c1-9-7-11(10-5-3-2-4-6-10)14-16(9)13-8-12(17)15-19(13)18/h2-8H,1H3,(H,15,17) |
| InChIKey | NJWMMRDAKIOVSZ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |