C15H15N5O2 — CID 177460733
1,3-dimethyl-5-(5-methyl-3-phenylpyrazol-1-yl)-4-nitropyrazole (PubChem CID 177460733) has the molecular formula C15H15N5O2 and a molecular weight of 297.32 g/mol. Its IUPAC name is 1,3-dimethyl-5-(5-methyl-3-phenylpyrazol-1-yl)-4-nitropyrazole.
| Compound Name | 1,3-dimethyl-5-(5-methyl-3-phenylpyrazol-1-yl)-4-nitropyrazole |
|---|---|
| PubChem CID | 177460733 |
| Molecular Formula | C15H15N5O2 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 1,3-dimethyl-5-(5-methyl-3-phenylpyrazol-1-yl)-4-nitropyrazole |
| SMILES | Cc1nn(C)c(-n2nc(-c3ccccc3)cc2C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15N5O2/c1-10-9-13(12-7-5-4-6-8-12)17-19(10)15-14(20(21)22)11(2)16-18(15)3/h4-9H,1-3H3 |
| InChIKey | PJJCGTOBFMFGOQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 78.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|