About 5-[5-(5-morpholin-4-ylpyrazin-2-yl)indazol-1-yl]-1-oxo-1,2-thiazol-3-one
5-[5-(5-morpholin-4-ylpyrazin-2-yl)indazol-1-yl]-1-oxo-1,2-thiazol-3-one (PubChem CID 140960413) has the molecular formula C18H16N6O3S
and a molecular weight of 396.43 g/mol. Its IUPAC name is 5-[5-(5-morpholin-4-ylpyrazin-2-yl)indazol-1-yl]-1-oxo-1,2-thiazol-3-one.
Molecular Properties
| Compound Name | 5-[5-(5-morpholin-4-ylpyrazin-2-yl)indazol-1-yl]-1-oxo-1,2-thiazol-3-one |
| PubChem CID | 140960413 |
| Molecular Formula | C18H16N6O3S |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 5-[5-(5-morpholin-4-ylpyrazin-2-yl)indazol-1-yl]-1-oxo-1,2-thiazol-3-one |
| SMILES | O=C1C=C(n2ncc3cc(-c4cnc(N5CCOCC5)cn4)ccc32)S(=O)N1 |
| InChI | InChI=1S/C18H16N6O3S/c25-17-8-18(28(26)22-17)24-15-2-1-12(7-13(15)9-21-24)14-10-20-16(11-19-14)23-3-5-27-6-4-23/h1-2,7-11H,3-6H2,(H,22,25) |
| InChIKey | IAHSVHNOJUAFKW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 5-[5-(5-morpholin-4-ylpyrazin-2-yl)indazol-1-yl]-1-oxo-1,2-thiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-(5-morpholin-4-ylpyrazin-2-yl)indazol-1-yl]-1-oxo-1,2-thiazol-3-one?
The IUPAC name of 5-[5-(5-morpholin-4-ylpyrazin-2-yl)indazol-1-yl]-1-oxo-1,2-thiazol-3-one (CID 140960413) is 5-[5-(5-morpholin-4-ylpyrazin-2-yl)indazol-1-yl]-1-oxo-1,2-thiazol-3-one.
What is the SMILES notation for 5-[5-(5-morpholin-4-ylpyrazin-2-yl)indazol-1-yl]-1-oxo-1,2-thiazol-3-one?
The canonical SMILES for 5-[5-(5-morpholin-4-ylpyrazin-2-yl)indazol-1-yl]-1-oxo-1,2-thiazol-3-one is O=C1C=C(n2ncc3cc(-c4cnc(N5CCOCC5)cn4)ccc32)S(=O)N1.
What is the InChIKey of 5-[5-(5-morpholin-4-ylpyrazin-2-yl)indazol-1-yl]-1-oxo-1,2-thiazol-3-one?
The InChIKey is IAHSVHNOJUAFKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N6O3S/c25-17-8-18(28(26)22-17)24-15-2-1-12(7-13(15)9-21-24)14-10-20-16(11-19-14)23-3-5-27-6-4-23/h1-2,7-11H,3-6H2,(H,22,25).
What are the key properties of 5-[5-(5-morpholin-4-ylpyrazin-2-yl)indazol-1-yl]-1-oxo-1,2-thiazol-3-one?
5-[5-(5-morpholin-4-ylpyrazin-2-yl)indazol-1-yl]-1-oxo-1,2-thiazol-3-one has a molecular weight of 396.43 g/mol, XLogP of 0.92, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-(5-morpholin-4-ylpyrazin-2-yl)indazol-1-yl]-1-oxo-1,2-thiazol-3-one is sourced from PubChem (CID 140960413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).