C33H28F6N4O — CID 150970558
bis[4-[3-(trifluoromethyl)anilino]-5,6,7,8-tetrahydroisoquinolin-1-yl]methanone (PubChem CID 150970558) has the molecular formula C33H28F6N4O and a molecular weight of 610.60 g/mol. Its IUPAC name is bis[4-[3-(trifluoromethyl)anilino]-5,6,7,8-tetrahydroisoquinolin-1-yl]methanone.
| Compound Name | bis[4-[3-(trifluoromethyl)anilino]-5,6,7,8-tetrahydroisoquinolin-1-yl]methanone |
|---|---|
| PubChem CID | 150970558 |
| Molecular Formula | C33H28F6N4O |
| Molecular Weight | 610.60 g/mol |
| Exact Mass | 610.22 |
| IUPAC Name | bis[4-[3-(trifluoromethyl)anilino]-5,6,7,8-tetrahydroisoquinolin-1-yl]methanone |
| SMILES | O=C(c1ncc(Nc2cccc(C(F)(F)F)c2)c2c1CCCC2)c1ncc(Nc2cccc(C(F)(F)F)c2)c2c1CCCC2 |
| InChI | InChI=1S/C33H28F6N4O/c34-32(35,36)19-7-5-9-21(15-19)42-27-17-40-29(25-13-3-1-11-23(25)27)31(44)30-26-14-4-2-12-24(26)28(18-41-30)43-22-10-6-8-20(16-22)33(37,38)39/h5-10,15-18,42-43H,1-4,11-14H2 |
| InChIKey | LOABSRLXPIFHPU-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.60 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |