C18H32O4 — CID 15097252
6-[7-(oxan-2-yloxy)heptoxymethyl]-3,4-dihydro-2H-pyran (PubChem CID 15097252) has the molecular formula C18H32O4 and a molecular weight of 312.45 g/mol. Its IUPAC name is 6-[7-(oxan-2-yloxy)heptoxymethyl]-3,4-dihydro-2H-pyran.
| Compound Name | 6-[7-(oxan-2-yloxy)heptoxymethyl]-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 15097252 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | 6-[7-(oxan-2-yloxy)heptoxymethyl]-3,4-dihydro-2H-pyran |
| SMILES | C1=C(COCCCCCCCOC2CCCCO2)OCCC1 |
| InChI | InChI=1S/C18H32O4/c1(3-7-14-21-18-11-5-9-15-22-18)2-6-12-19-16-17-10-4-8-13-20-17/h10,18H,1-9,11-16H2 |
| InChIKey | HENVSHGZBGEBLJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|