C11H20N4O2S2 — CID 15100225
1-methyl-N-(3-thiomorpholin-4-ylpropyl)imidazole-4-sulfonamide (PubChem CID 15100225) has the molecular formula C11H20N4O2S2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 1-methyl-N-(3-thiomorpholin-4-ylpropyl)imidazole-4-sulfonamide.
| Compound Name | 1-methyl-N-(3-thiomorpholin-4-ylpropyl)imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 15100225 |
| Molecular Formula | C11H20N4O2S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 1-methyl-N-(3-thiomorpholin-4-ylpropyl)imidazole-4-sulfonamide |
| SMILES | Cn1cnc(S(=O)(=O)NCCCN2CCSCC2)c1 |
| InChI | InChI=1S/C11H20N4O2S2/c1-14-9-11(12-10-14)19(16,17)13-3-2-4-15-5-7-18-8-6-15/h9-10,13H,2-8H2,1H3 |
| InChIKey | FGBXLRWXEHYWQQ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|