C23H28N2O4S — CID 151010062
2-[4-[5-(cyclohexylcarbamoyl)-6-propylsulfanyl-2-pyridinyl]-2-hydroxyphenyl]acetic acid (PubChem CID 151010062) has the molecular formula C23H28N2O4S and a molecular weight of 428.55 g/mol. Its IUPAC name is 2-[4-[5-(cyclohexylcarbamoyl)-6-propylsulfanyl-2-pyridinyl]-2-hydroxyphenyl]acetic acid.
| Compound Name | 2-[4-[5-(cyclohexylcarbamoyl)-6-propylsulfanyl-2-pyridinyl]-2-hydroxyphenyl]acetic acid |
|---|---|
| PubChem CID | 151010062 |
| Molecular Formula | C23H28N2O4S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 2-[4-[5-(cyclohexylcarbamoyl)-6-propylsulfanyl-2-pyridinyl]-2-hydroxyphenyl]acetic acid |
| SMILES | CCCSc1nc(-c2ccc(CC(=O)O)c(O)c2)ccc1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C23H28N2O4S/c1-2-12-30-23-18(22(29)24-17-6-4-3-5-7-17)10-11-19(25-23)15-8-9-16(14-21(27)28)20(26)13-15/h8-11,13,17,26H,2-7,12,14H2,1H3,(H,24,29)(H,27,28) |
| InChIKey | LVXAAIROLVVYKM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |