C21H32N3O3S+ — CID 69178250
1-[5-(cyclohexylcarbamoyl)-6-propylsulfanyl-2-pyridinyl]piperidin-1-ium-1-carboxylic acid (PubChem CID 69178250) has the molecular formula C21H32N3O3S+ and a molecular weight of 406.57 g/mol. Its IUPAC name is 1-[5-(cyclohexylcarbamoyl)-6-propylsulfanyl-2-pyridinyl]piperidin-1-ium-1-carboxylic acid.
| Compound Name | 1-[5-(cyclohexylcarbamoyl)-6-propylsulfanyl-2-pyridinyl]piperidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 69178250 |
| Molecular Formula | C21H32N3O3S+ |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | 1-[5-(cyclohexylcarbamoyl)-6-propylsulfanyl-2-pyridinyl]piperidin-1-ium-1-carboxylic acid |
| SMILES | CCCSc1nc([N+]2(C(=O)O)CCCCC2)ccc1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C21H31N3O3S/c1-2-15-28-20-17(19(25)22-16-9-5-3-6-10-16)11-12-18(23-20)24(21(26)27)13-7-4-8-14-24/h11-12,16H,2-10,13-15H2,1H3,(H-,22,25,26,27)/p+1 |
| InChIKey | PTKFOCOMVHCRMC-UHFFFAOYSA-O |
| XLogP | 4.82 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|