C18H27N3O3S — CID 24946976
3-[[5-(cyclohexylcarbamoyl)-6-propylsulfanyl-2-pyridinyl]amino]propanoic acid (PubChem CID 24946976) has the molecular formula C18H27N3O3S and a molecular weight of 365.50 g/mol. Its IUPAC name is 3-[[5-(cyclohexylcarbamoyl)-6-propylsulfanyl-2-pyridinyl]amino]propanoic acid.
| Compound Name | 3-[[5-(cyclohexylcarbamoyl)-6-propylsulfanyl-2-pyridinyl]amino]propanoic acid |
|---|---|
| PubChem CID | 24946976 |
| Molecular Formula | C18H27N3O3S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 3-[[5-(cyclohexylcarbamoyl)-6-propylsulfanyl-2-pyridinyl]amino]propanoic acid |
| SMILES | CCCSc1nc(NCCC(=O)O)ccc1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C18H27N3O3S/c1-2-12-25-18-14(17(24)20-13-6-4-3-5-7-13)8-9-15(21-18)19-11-10-16(22)23/h8-9,13H,2-7,10-12H2,1H3,(H,19,21)(H,20,24)(H,22,23) |
| InChIKey | TWSMMGCFKFUITI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |