About (8R)-8-methoxy-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one
(8R)-8-methoxy-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one (PubChem CID 15102594) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is (8R)-8-methoxy-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one.
Analyze (8R)-8-methoxy-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8R)-8-methoxy-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one?
The IUPAC name of (8R)-8-methoxy-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one (CID 15102594) is (8R)-8-methoxy-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one.
What is the SMILES notation for (8R)-8-methoxy-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one?
The canonical SMILES for (8R)-8-methoxy-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one is CO[C@@]12CCCN1C(=O)CC2.
What is the InChIKey of (8R)-8-methoxy-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one?
The InChIKey is GDAIAQLKZOBITI-MRVPVSSYSA-N. The full InChI is InChI=1S/C8H13NO2/c1-11-8-4-2-6-9(8)7(10)3-5-8/h2-6H2,1H3/t8-/m1/s1.
What are the key properties of (8R)-8-methoxy-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one?
(8R)-8-methoxy-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one has a molecular weight of 155.20 g/mol, XLogP of 0.75, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (8R)-8-methoxy-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one is sourced from PubChem (CID 15102594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).