C41H31F3N8O2 — CID 151028769
5-[1-methyl-5-[[5-(trifluoromethyl)-2-pyridinyl]oxymethyl]pyrazol-4-yl]-3-[3-[1-(2,2,2-triphenylethyl)-1,2,4-triazol-3-yl]phenyl]-1,2,4-oxadiazole (PubChem CID 151028769) has the molecular formula C41H31F3N8O2 and a molecular weight of 724.75 g/mol. Its IUPAC name is 5-[1-methyl-5-[[5-(trifluoromethyl)-2-pyridinyl]oxymethyl]pyrazol-4-yl]-3-[3-[1-(2,2,2-triphenylethyl)-1,2,4-triazol-3-yl]phenyl]-1,2,4-oxadiazole.
| Compound Name | 5-[1-methyl-5-[[5-(trifluoromethyl)-2-pyridinyl]oxymethyl]pyrazol-4-yl]-3-[3-[1-(2,2,2-triphenylethyl)-1,2,4-triazol-3-yl]phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 151028769 |
| Molecular Formula | C41H31F3N8O2 |
| Molecular Weight | 724.75 g/mol |
| Exact Mass | 724.25 |
| IUPAC Name | 5-[1-methyl-5-[[5-(trifluoromethyl)-2-pyridinyl]oxymethyl]pyrazol-4-yl]-3-[3-[1-(2,2,2-triphenylethyl)-1,2,4-triazol-3-yl]phenyl]-1,2,4-oxadiazole |
| SMILES | Cn1ncc(-c2nc(-c3cccc(-c4ncn(CC(c5ccccc5)(c5ccccc5)c5ccccc5)n4)c3)no2)c1COc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C41H31F3N8O2/c1-51-35(25-53-36-21-20-33(23-45-36)41(42,43)44)34(24-47-51)39-48-38(50-54-39)29-13-11-12-28(22-29)37-46-27-52(49-37)26-40(30-14-5-2-6-15-30,31-16-7-3-8-17-31)32-18-9-4-10-19-32/h2-24,27H,25-26H2,1H3 |
| InChIKey | LZPNSCPJUYRZQX-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 109.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.75 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|