About 7-pyrrolidin-3-yl-1H-pyrrolo[3,2-c]quinolin-4-amine
7-pyrrolidin-3-yl-1H-pyrrolo[3,2-c]quinolin-4-amine (PubChem CID 151028917) has the molecular formula C15H16N4
and a molecular weight of 252.32 g/mol. Its IUPAC name is 7-pyrrolidin-3-yl-1H-pyrrolo[3,2-c]quinolin-4-amine.
Molecular Properties
| Compound Name | 7-pyrrolidin-3-yl-1H-pyrrolo[3,2-c]quinolin-4-amine |
| PubChem CID | 151028917 |
| Molecular Formula | C15H16N4 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 7-pyrrolidin-3-yl-1H-pyrrolo[3,2-c]quinolin-4-amine |
| SMILES | Nc1nc2cc(C3CCNC3)ccc2c2[nH]ccc12 |
| InChI | InChI=1S/C15H16N4/c16-15-12-4-6-18-14(12)11-2-1-9(7-13(11)19-15)10-3-5-17-8-10/h1-2,4,6-7,10,17-18H,3,5,8H2,(H2,16,19) |
| InChIKey | LZQHMKKYLGMFOU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-pyrrolidin-3-yl-1H-pyrrolo[3,2-c]quinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-pyrrolidin-3-yl-1H-pyrrolo[3,2-c]quinolin-4-amine?
The IUPAC name of 7-pyrrolidin-3-yl-1H-pyrrolo[3,2-c]quinolin-4-amine (CID 151028917) is 7-pyrrolidin-3-yl-1H-pyrrolo[3,2-c]quinolin-4-amine.
What is the SMILES notation for 7-pyrrolidin-3-yl-1H-pyrrolo[3,2-c]quinolin-4-amine?
The canonical SMILES for 7-pyrrolidin-3-yl-1H-pyrrolo[3,2-c]quinolin-4-amine is Nc1nc2cc(C3CCNC3)ccc2c2[nH]ccc12.
What is the InChIKey of 7-pyrrolidin-3-yl-1H-pyrrolo[3,2-c]quinolin-4-amine?
The InChIKey is LZQHMKKYLGMFOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N4/c16-15-12-4-6-18-14(12)11-2-1-9(7-13(11)19-15)10-3-5-17-8-10/h1-2,4,6-7,10,17-18H,3,5,8H2,(H2,16,19).
What are the key properties of 7-pyrrolidin-3-yl-1H-pyrrolo[3,2-c]quinolin-4-amine?
7-pyrrolidin-3-yl-1H-pyrrolo[3,2-c]quinolin-4-amine has a molecular weight of 252.32 g/mol, XLogP of 2.38, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-pyrrolidin-3-yl-1H-pyrrolo[3,2-c]quinolin-4-amine is sourced from PubChem (CID 151028917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).