C15H16N4 — CID 151028917
7-pyrrolidin-3-yl-1H-pyrrolo[3,2-c]quinolin-4-amine (PubChem CID 151028917) has the molecular formula C15H16N4 and a molecular weight of 252.32 g/mol. Its IUPAC name is 7-pyrrolidin-3-yl-1H-pyrrolo[3,2-c]quinolin-4-amine.
| Compound Name | 7-pyrrolidin-3-yl-1H-pyrrolo[3,2-c]quinolin-4-amine |
|---|---|
| PubChem CID | 151028917 |
| Molecular Formula | C15H16N4 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 7-pyrrolidin-3-yl-1H-pyrrolo[3,2-c]quinolin-4-amine |
| SMILES | Nc1nc2cc(C3CCNC3)ccc2c2[nH]ccc12 |
| InChI | InChI=1S/C15H16N4/c16-15-12-4-6-18-14(12)11-2-1-9(7-13(11)19-15)10-3-5-17-8-10/h1-2,4,6-7,10,17-18H,3,5,8H2,(H2,16,19) |
| InChIKey | LZQHMKKYLGMFOU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |