C28H22F3NO — CID 151044510
1-amino-2-(9H-fluoren-1-yl)-3,3,3-trifluoro-1,1-diphenylpropan-2-ol (PubChem CID 151044510) has the molecular formula C28H22F3NO and a molecular weight of 445.48 g/mol. Its IUPAC name is 1-amino-2-(9H-fluoren-1-yl)-3,3,3-trifluoro-1,1-diphenylpropan-2-ol.
| Compound Name | 1-amino-2-(9H-fluoren-1-yl)-3,3,3-trifluoro-1,1-diphenylpropan-2-ol |
|---|---|
| PubChem CID | 151044510 |
| Molecular Formula | C28H22F3NO |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 1-amino-2-(9H-fluoren-1-yl)-3,3,3-trifluoro-1,1-diphenylpropan-2-ol |
| SMILES | NC(c1ccccc1)(c1ccccc1)C(O)(c1cccc2c1Cc1ccccc1-2)C(F)(F)F |
| InChI | InChI=1S/C28H22F3NO/c29-28(30,31)27(33,25-17-9-16-23-22-15-8-7-10-19(22)18-24(23)25)26(32,20-11-3-1-4-12-20)21-13-5-2-6-14-21/h1-17,33H,18,32H2 |
| InChIKey | MCUBFHWBCACSEE-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |