C25H33N3O — CID 15104502
5-[4-[4-[4-(4-methylphenyl)piperazin-1-yl]butyl]phenyl]pyrrolidin-2-one (PubChem CID 15104502) has the molecular formula C25H33N3O and a molecular weight of 391.56 g/mol. Its IUPAC name is 5-[4-[4-[4-(4-methylphenyl)piperazin-1-yl]butyl]phenyl]pyrrolidin-2-one.
| Compound Name | 5-[4-[4-[4-(4-methylphenyl)piperazin-1-yl]butyl]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 15104502 |
| Molecular Formula | C25H33N3O |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | 5-[4-[4-[4-(4-methylphenyl)piperazin-1-yl]butyl]phenyl]pyrrolidin-2-one |
| SMILES | Cc1ccc(N2CCN(CCCCc3ccc(C4CCC(=O)N4)cc3)CC2)cc1 |
| InChI | InChI=1S/C25H33N3O/c1-20-5-11-23(12-6-20)28-18-16-27(17-19-28)15-3-2-4-21-7-9-22(10-8-21)24-13-14-25(29)26-24/h5-12,24H,2-4,13-19H2,1H3,(H,26,29) |
| InChIKey | QFKBJGHEROSFIQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|