C25H28F3N3O2 — CID 139711919
5-[4-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butanoyl]phenyl]pyrrolidin-2-one (PubChem CID 139711919) has the molecular formula C25H28F3N3O2 and a molecular weight of 459.51 g/mol. Its IUPAC name is 5-[4-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butanoyl]phenyl]pyrrolidin-2-one.
| Compound Name | 5-[4-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butanoyl]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 139711919 |
| Molecular Formula | C25H28F3N3O2 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 5-[4-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butanoyl]phenyl]pyrrolidin-2-one |
| SMILES | O=C1CCC(c2ccc(C(=O)CCCN3CCN(c4cccc(C(F)(F)F)c4)CC3)cc2)N1 |
| InChI | InChI=1S/C25H28F3N3O2/c26-25(27,28)20-3-1-4-21(17-20)31-15-13-30(14-16-31)12-2-5-23(32)19-8-6-18(7-9-19)22-10-11-24(33)29-22/h1,3-4,6-9,17,22H,2,5,10-16H2,(H,29,33) |
| InChIKey | OWYAZDXICDBFQQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |