C25H30F3N3O — CID 23048806
5-[4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]phenyl]pyrrolidin-2-one (PubChem CID 23048806) has the molecular formula C25H30F3N3O and a molecular weight of 445.53 g/mol. Its IUPAC name is 5-[4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]phenyl]pyrrolidin-2-one.
| Compound Name | 5-[4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 23048806 |
| Molecular Formula | C25H30F3N3O |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 5-[4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]phenyl]pyrrolidin-2-one |
| SMILES | CCC(Cc1ccc(C2CCC(=O)N2)cc1)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C25H30F3N3O/c1-2-21(16-18-6-8-19(9-7-18)23-10-11-24(32)29-23)30-12-14-31(15-13-30)22-5-3-4-20(17-22)25(26,27)28/h3-9,17,21,23H,2,10-16H2,1H3,(H,29,32) |
| InChIKey | VXKSQRBBHGBMNF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |