C25H34O4Si — CID 15105057
methyl (2R)-2-[(2S,3R,4S,5S)-3-[dimethyl(phenyl)silyl]-4-methyl-5-(phenylmethoxymethyl)oxolan-2-yl]propanoate (PubChem CID 15105057) has the molecular formula C25H34O4Si and a molecular weight of 426.63 g/mol. Its IUPAC name is methyl (2R)-2-[(2S,3R,4S,5S)-3-[dimethyl(phenyl)silyl]-4-methyl-5-(phenylmethoxymethyl)oxolan-2-yl]propanoate.
| Compound Name | methyl (2R)-2-[(2S,3R,4S,5S)-3-[dimethyl(phenyl)silyl]-4-methyl-5-(phenylmethoxymethyl)oxolan-2-yl]propanoate |
|---|---|
| PubChem CID | 15105057 |
| Molecular Formula | C25H34O4Si |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | methyl (2R)-2-[(2S,3R,4S,5S)-3-[dimethyl(phenyl)silyl]-4-methyl-5-(phenylmethoxymethyl)oxolan-2-yl]propanoate |
| SMILES | COC(=O)[C@H](C)[C@@H]1O[C@H](COCc2ccccc2)[C@H](C)[C@H]1[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C25H34O4Si/c1-18-22(17-28-16-20-12-8-6-9-13-20)29-23(19(2)25(26)27-3)24(18)30(4,5)21-14-10-7-11-15-21/h6-15,18-19,22-24H,16-17H2,1-5H3/t18-,19+,22+,23-,24+/m0/s1 |
| InChIKey | PMFCCVJYAMPDDU-QENKCHOGSA-N |
| XLogP | 4.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|