C23H34N2OP2S2 — CID 15105655
1,3-bis[tert-butyl(phenyl)phosphinothioyl]-1,3-dimethylurea (PubChem CID 15105655) has the molecular formula C23H34N2OP2S2 and a molecular weight of 480.62 g/mol. Its IUPAC name is 1,3-bis[tert-butyl(phenyl)phosphinothioyl]-1,3-dimethylurea.
| Compound Name | 1,3-bis[tert-butyl(phenyl)phosphinothioyl]-1,3-dimethylurea |
|---|---|
| PubChem CID | 15105655 |
| Molecular Formula | C23H34N2OP2S2 |
| Molecular Weight | 480.62 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | 1,3-bis[tert-butyl(phenyl)phosphinothioyl]-1,3-dimethylurea |
| SMILES | CN(C(=O)N(C)P(=S)(c1ccccc1)C(C)(C)C)P(=S)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H34N2OP2S2/c1-22(2,3)27(29,19-15-11-9-12-16-19)24(7)21(26)25(8)28(30,23(4,5)6)20-17-13-10-14-18-20/h9-18H,1-8H3 |
| InChIKey | CWOGZMGPFJRLRX-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.62 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|