C15H22BFO3 — CID 151058470
[2-fluoro-3-(4-propylcyclohexyl)phenoxy]boronic acid (PubChem CID 151058470) has the molecular formula C15H22BFO3 and a molecular weight of 280.15 g/mol. Its IUPAC name is [2-fluoro-3-(4-propylcyclohexyl)phenoxy]boronic acid.
| Compound Name | [2-fluoro-3-(4-propylcyclohexyl)phenoxy]boronic acid |
|---|---|
| PubChem CID | 151058470 |
| Molecular Formula | C15H22BFO3 |
| Molecular Weight | 280.15 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | [2-fluoro-3-(4-propylcyclohexyl)phenoxy]boronic acid |
| SMILES | CCCC1CCC(c2cccc(OB(O)O)c2F)CC1 |
| InChI | InChI=1S/C15H22BFO3/c1-2-4-11-7-9-12(10-8-11)13-5-3-6-14(15(13)17)20-16(18)19/h3,5-6,11-12,18-19H,2,4,7-10H2,1H3 |
| InChIKey | MFQQUAMRDHSVCU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.15 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|