C13H12N4O5S — CID 151059824
[3-methoxy-4-(4-oxo-3H-imidazo[2,1-f][1,2,4]triazin-6-yl)phenyl] methanesulfonate (PubChem CID 151059824) has the molecular formula C13H12N4O5S and a molecular weight of 336.33 g/mol. Its IUPAC name is [3-methoxy-4-(4-oxo-3H-imidazo[2,1-f][1,2,4]triazin-6-yl)phenyl] methanesulfonate.
| Compound Name | [3-methoxy-4-(4-oxo-3H-imidazo[2,1-f][1,2,4]triazin-6-yl)phenyl] methanesulfonate |
|---|---|
| PubChem CID | 151059824 |
| Molecular Formula | C13H12N4O5S |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | [3-methoxy-4-(4-oxo-3H-imidazo[2,1-f][1,2,4]triazin-6-yl)phenyl] methanesulfonate |
| SMILES | COc1cc(OS(C)(=O)=O)ccc1-c1cn2nc[nH]c(=O)c2n1 |
| InChI | InChI=1S/C13H12N4O5S/c1-21-11-5-8(22-23(2,19)20)3-4-9(11)10-6-17-12(16-10)13(18)14-7-15-17/h3-7H,1-2H3,(H,14,15,18) |
| InChIKey | MFXSZSJQBJGUII-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|