C33H41BrF3N5OSi — CID 151071401
N-[(3S)-1-benzyl-5,5-dimethylpiperidin-3-yl]-4-[6-bromo-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 151071401) has the molecular formula C33H41BrF3N5OSi and a molecular weight of 688.71 g/mol. Its IUPAC name is N-[(3S)-1-benzyl-5,5-dimethylpiperidin-3-yl]-4-[6-bromo-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-[(3S)-1-benzyl-5,5-dimethylpiperidin-3-yl]-4-[6-bromo-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 151071401 |
| Molecular Formula | C33H41BrF3N5OSi |
| Molecular Weight | 688.71 g/mol |
| Exact Mass | 687.22 |
| IUPAC Name | N-[(3S)-1-benzyl-5,5-dimethylpiperidin-3-yl]-4-[6-bromo-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CC1(C)C[C@H](Nc2ncc(C(F)(F)F)c(-c3cn(COCC[Si](C)(C)C)c4cc(Br)ccc34)n2)CN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C33H41BrF3N5OSi/c1-32(2)16-25(19-41(21-32)18-23-9-7-6-8-10-23)39-31-38-17-28(33(35,36)37)30(40-31)27-20-42(22-43-13-14-44(3,4)5)29-15-24(34)11-12-26(27)29/h6-12,15,17,20,25H,13-14,16,18-19,21-22H2,1-5H3,(H,38,39,40)/t25-/m0/s1 |
| InChIKey | MIFDBGDVYBTZRB-VWLOTQADSA-N |
| XLogP | 8.90 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.71 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|