C25H20O6 — CID 15107212
benzyl 4-(4,5-dihydroxy-10-oxo-9H-anthracen-9-yl)-4-oxobutanoate (PubChem CID 15107212) has the molecular formula C25H20O6 and a molecular weight of 416.43 g/mol. Its IUPAC name is benzyl 4-(4,5-dihydroxy-10-oxo-9H-anthracen-9-yl)-4-oxobutanoate.
| Compound Name | benzyl 4-(4,5-dihydroxy-10-oxo-9H-anthracen-9-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 15107212 |
| Molecular Formula | C25H20O6 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | benzyl 4-(4,5-dihydroxy-10-oxo-9H-anthracen-9-yl)-4-oxobutanoate |
| SMILES | O=C(CCC(=O)C1c2cccc(O)c2C(=O)c2c(O)cccc21)OCc1ccccc1 |
| InChI | InChI=1S/C25H20O6/c26-18-10-4-8-16-22(17-9-5-11-19(27)24(17)25(30)23(16)18)20(28)12-13-21(29)31-14-15-6-2-1-3-7-15/h1-11,22,26-27H,12-14H2 |
| InChIKey | XHFRJRIGZVGCFW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |