About 6-methyl-5H-pyrrolo[3,2-d]pyrimidine-7-carboxylic acid
6-methyl-5H-pyrrolo[3,2-d]pyrimidine-7-carboxylic acid (PubChem CID 151076483) has the molecular formula C8H7N3O2
and a molecular weight of 177.16 g/mol. Its IUPAC name is 6-methyl-5H-pyrrolo[3,2-d]pyrimidine-7-carboxylic acid.
Analyze 6-methyl-5H-pyrrolo[3,2-d]pyrimidine-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-5H-pyrrolo[3,2-d]pyrimidine-7-carboxylic acid?
The IUPAC name of 6-methyl-5H-pyrrolo[3,2-d]pyrimidine-7-carboxylic acid (CID 151076483) is 6-methyl-5H-pyrrolo[3,2-d]pyrimidine-7-carboxylic acid.
What is the SMILES notation for 6-methyl-5H-pyrrolo[3,2-d]pyrimidine-7-carboxylic acid?
The canonical SMILES for 6-methyl-5H-pyrrolo[3,2-d]pyrimidine-7-carboxylic acid is Cc1[nH]c2cncnc2c1C(=O)O.
What is the InChIKey of 6-methyl-5H-pyrrolo[3,2-d]pyrimidine-7-carboxylic acid?
The InChIKey is MJFJKTGDMDBSMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O2/c1-4-6(8(12)13)7-5(11-4)2-9-3-10-7/h2-3,11H,1H3,(H,12,13).
What are the key properties of 6-methyl-5H-pyrrolo[3,2-d]pyrimidine-7-carboxylic acid?
6-methyl-5H-pyrrolo[3,2-d]pyrimidine-7-carboxylic acid has a molecular weight of 177.16 g/mol, XLogP of 0.96, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-5H-pyrrolo[3,2-d]pyrimidine-7-carboxylic acid is sourced from PubChem (CID 151076483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).