C8H10O2S — CID 151092517
2,3,5,6-tetrahydro-1-benzothiophene-2,3-diol (PubChem CID 151092517) has the molecular formula C8H10O2S and a molecular weight of 170.23 g/mol. Its IUPAC name is 2,3,5,6-tetrahydro-1-benzothiophene-2,3-diol.
| Compound Name | 2,3,5,6-tetrahydro-1-benzothiophene-2,3-diol |
|---|---|
| PubChem CID | 151092517 |
| Molecular Formula | C8H10O2S |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | 2,3,5,6-tetrahydro-1-benzothiophene-2,3-diol |
| SMILES | OC1SC2=CCCC=C2C1O |
| InChI | InChI=1S/C8H10O2S/c9-7-5-3-1-2-4-6(5)11-8(7)10/h3-4,7-10H,1-2H2 |
| InChIKey | MMKSZBZSCNFPTD-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |