C19H34O2S — CID 144565321
ethane;(Z,3E)-3-ethylidene-1-[(3E,5Z)-hepta-1,3,5-trien-3-yl]sulfanylhept-4-ene-1,2-diol;methane (PubChem CID 144565321) has the molecular formula C19H34O2S and a molecular weight of 326.55 g/mol. Its IUPAC name is ethane;(Z,3E)-3-ethylidene-1-[(3E,5Z)-hepta-1,3,5-trien-3-yl]sulfanylhept-4-ene-1,2-diol;methane.
| Compound Name | ethane;(Z,3E)-3-ethylidene-1-[(3E,5Z)-hepta-1,3,5-trien-3-yl]sulfanylhept-4-ene-1,2-diol;methane |
|---|---|
| PubChem CID | 144565321 |
| Molecular Formula | C19H34O2S |
| Molecular Weight | 326.55 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | ethane;(Z,3E)-3-ethylidene-1-[(3E,5Z)-hepta-1,3,5-trien-3-yl]sulfanylhept-4-ene-1,2-diol;methane |
| SMILES | C.C=C/C(=C\C=C/C)SC(O)C(O)C(/C=C\CC)=C/C.CC |
| InChI | InChI=1S/C16H24O2S.C2H6.CH4/c1-5-9-11-13(7-3)15(17)16(18)19-14(8-4)12-10-6-2;1-2;/h6-12,15-18H,4-5H2,1-3H3;1-2H3;1H4/b10-6-,11-9-,13-7+,14-12+;; |
| InChIKey | IVPGSRYGHIMEGR-RBBXBJDCSA-N |
| XLogP | 5.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|