C8H16O2S — CID 143639829
5-methyl-1-methylsulfanylhex-4-ene-2,3-diol (PubChem CID 143639829) has the molecular formula C8H16O2S and a molecular weight of 176.28 g/mol. Its IUPAC name is 5-methyl-1-methylsulfanylhex-4-ene-2,3-diol.
| Compound Name | 5-methyl-1-methylsulfanylhex-4-ene-2,3-diol |
|---|---|
| PubChem CID | 143639829 |
| Molecular Formula | C8H16O2S |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 5-methyl-1-methylsulfanylhex-4-ene-2,3-diol |
| SMILES | CSCC(O)C(O)C=C(C)C |
| InChI | InChI=1S/C8H16O2S/c1-6(2)4-7(9)8(10)5-11-3/h4,7-10H,5H2,1-3H3 |
| InChIKey | ZIJXXXDHNVNSTJ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|