C22H23BrN2O4S — CID 151100927
tert-butyl N-[2-[(E)-2-[3-bromo-4-(methoxymethoxy)phenyl]ethenyl]-1,3-benzothiazol-6-yl]carbamate (PubChem CID 151100927) has the molecular formula C22H23BrN2O4S and a molecular weight of 491.41 g/mol. Its IUPAC name is tert-butyl N-[2-[(E)-2-[3-bromo-4-(methoxymethoxy)phenyl]ethenyl]-1,3-benzothiazol-6-yl]carbamate.
| Compound Name | tert-butyl N-[2-[(E)-2-[3-bromo-4-(methoxymethoxy)phenyl]ethenyl]-1,3-benzothiazol-6-yl]carbamate |
|---|---|
| PubChem CID | 151100927 |
| Molecular Formula | C22H23BrN2O4S |
| Molecular Weight | 491.41 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | tert-butyl N-[2-[(E)-2-[3-bromo-4-(methoxymethoxy)phenyl]ethenyl]-1,3-benzothiazol-6-yl]carbamate |
| SMILES | COCOc1ccc(/C=C/c2nc3ccc(NC(=O)OC(C)(C)C)cc3s2)cc1Br |
| InChI | InChI=1S/C22H23BrN2O4S/c1-22(2,3)29-21(26)24-15-7-8-17-19(12-15)30-20(25-17)10-6-14-5-9-18(16(23)11-14)28-13-27-4/h5-12H,13H2,1-4H3,(H,24,26)/b10-6+ |
| InChIKey | MOCHVGQLFVYGQU-UXBLZVDNSA-N |
| XLogP | 6.56 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.41 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|