C15H23N7O2 — CID 151135340
butyl 2-(1-methyltetrazol-5-yl)-3-propan-2-yl-4,6-dihydropyrrolo[3,4-d]imidazole-5-carboxylate (PubChem CID 151135340) has the molecular formula C15H23N7O2 and a molecular weight of 333.40 g/mol. Its IUPAC name is butyl 2-(1-methyltetrazol-5-yl)-3-propan-2-yl-4,6-dihydropyrrolo[3,4-d]imidazole-5-carboxylate.
| Compound Name | butyl 2-(1-methyltetrazol-5-yl)-3-propan-2-yl-4,6-dihydropyrrolo[3,4-d]imidazole-5-carboxylate |
|---|---|
| PubChem CID | 151135340 |
| Molecular Formula | C15H23N7O2 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | butyl 2-(1-methyltetrazol-5-yl)-3-propan-2-yl-4,6-dihydropyrrolo[3,4-d]imidazole-5-carboxylate |
| SMILES | CCCCOC(=O)N1Cc2nc(-c3nnnn3C)n(C(C)C)c2C1 |
| InChI | InChI=1S/C15H23N7O2/c1-5-6-7-24-15(23)21-8-11-12(9-21)22(10(2)3)13(16-11)14-17-18-19-20(14)4/h10H,5-9H2,1-4H3 |
| InChIKey | MVCDMXZUROBJSH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 90.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|