C17H25BClNO5 — CID 151136506
[5-chloro-3-methyl-2-[[4-[(2-methylpropan-2-yl)oxycarbonyl]morpholin-2-yl]methyl]phenyl]boronic acid (PubChem CID 151136506) has the molecular formula C17H25BClNO5 and a molecular weight of 369.65 g/mol. Its IUPAC name is [5-chloro-3-methyl-2-[[4-[(2-methylpropan-2-yl)oxycarbonyl]morpholin-2-yl]methyl]phenyl]boronic acid.
| Compound Name | [5-chloro-3-methyl-2-[[4-[(2-methylpropan-2-yl)oxycarbonyl]morpholin-2-yl]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 151136506 |
| Molecular Formula | C17H25BClNO5 |
| Molecular Weight | 369.65 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | [5-chloro-3-methyl-2-[[4-[(2-methylpropan-2-yl)oxycarbonyl]morpholin-2-yl]methyl]phenyl]boronic acid |
| SMILES | Cc1cc(Cl)cc(B(O)O)c1CC1CN(C(=O)OC(C)(C)C)CCO1 |
| InChI | InChI=1S/C17H25BClNO5/c1-11-7-12(19)8-15(18(22)23)14(11)9-13-10-20(5-6-24-13)16(21)25-17(2,3)4/h7-8,13,22-23H,5-6,9-10H2,1-4H3 |
| InChIKey | MVHSUCKRZFTEFL-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.65 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|