C19H27BClNO5 — CID 174211073
2-[[4-chloro-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine-4-carboxylic acid (PubChem CID 174211073) has the molecular formula C19H27BClNO5 and a molecular weight of 395.69 g/mol. Its IUPAC name is 2-[[4-chloro-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine-4-carboxylic acid.
| Compound Name | 2-[[4-chloro-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine-4-carboxylic acid |
|---|---|
| PubChem CID | 174211073 |
| Molecular Formula | C19H27BClNO5 |
| Molecular Weight | 395.69 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 2-[[4-chloro-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine-4-carboxylic acid |
| SMILES | Cc1cc(Cl)cc(B2OC(C)(C)C(C)(C)O2)c1CC1CN(C(=O)O)CCO1 |
| InChI | InChI=1S/C19H27BClNO5/c1-12-8-13(21)9-16(20-26-18(2,3)19(4,5)27-20)15(12)10-14-11-22(17(23)24)6-7-25-14/h8-9,14H,6-7,10-11H2,1-5H3,(H,23,24) |
| InChIKey | FQMJMQZOTMTTLQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.69 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|