C23H32BClFN3O5 — CID 170961507
tert-butyl (2S)-2-[[5-chloro-3-fluoro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]methyl]morpholine-4-carboxylate (PubChem CID 170961507) has the molecular formula C23H32BClFN3O5 and a molecular weight of 495.79 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[5-chloro-3-fluoro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]methyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[5-chloro-3-fluoro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]methyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 170961507 |
| Molecular Formula | C23H32BClFN3O5 |
| Molecular Weight | 495.79 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | tert-butyl (2S)-2-[[5-chloro-3-fluoro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]methyl]morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCO[C@H](Cn2nc(F)c3cc(Cl)cc(B4OC(C)(C)C(C)(C)O4)c32)C1 |
| InChI | InChI=1S/C23H32BClFN3O5/c1-21(2,3)32-20(30)28-8-9-31-15(12-28)13-29-18-16(19(26)27-29)10-14(25)11-17(18)24-33-22(4,5)23(6,7)34-24/h10-11,15H,8-9,12-13H2,1-7H3/t15-/m0/s1 |
| InChIKey | MQKPJMDYSSORIC-HNNXBMFYSA-N |
| XLogP | 3.76 |
| TPSA | 75.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.79 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|