C31H33ClFN7O5 — CID 170961493
tert-butyl (2S)-2-[[5-chloro-7-[6-[(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-3-fluoroindazol-1-yl]methyl]morpholine-4-carboxylate (PubChem CID 170961493) has the molecular formula C31H33ClFN7O5 and a molecular weight of 638.10 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[5-chloro-7-[6-[(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-3-fluoroindazol-1-yl]methyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[5-chloro-7-[6-[(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-3-fluoroindazol-1-yl]methyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 170961493 |
| Molecular Formula | C31H33ClFN7O5 |
| Molecular Weight | 638.10 g/mol |
| Exact Mass | 637.22 |
| IUPAC Name | tert-butyl (2S)-2-[[5-chloro-7-[6-[(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-3-fluoroindazol-1-yl]methyl]morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCO[C@H](Cn2nc(F)c3cc(Cl)cc(-c4ncnn5cc(CN6C(=O)C7C(C6=O)C7(C)C)cc45)c32)C1 |
| InChI | InChI=1S/C31H33ClFN7O5/c1-30(2,3)45-29(43)37-6-7-44-18(13-37)14-40-25-19(9-17(32)10-20(25)26(33)36-40)24-21-8-16(12-39(21)35-15-34-24)11-38-27(41)22-23(28(38)42)31(22,4)5/h8-10,12,15,18,22-23H,6-7,11,13-14H2,1-5H3/t18-,22?,23?/m0/s1 |
| InChIKey | ABAWNUGTORALRP-NWLLBJEDSA-N |
| XLogP | 4.32 |
| TPSA | 124.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.10 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|