C28H32ClN5O3 — CID 170961413
3-[[4-[5-chloro-3-methyl-2-(1-piperidin-4-ylethoxy)phenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 170961413) has the molecular formula C28H32ClN5O3 and a molecular weight of 522.05 g/mol. Its IUPAC name is 3-[[4-[5-chloro-3-methyl-2-(1-piperidin-4-ylethoxy)phenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | 3-[[4-[5-chloro-3-methyl-2-(1-piperidin-4-ylethoxy)phenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 170961413 |
| Molecular Formula | C28H32ClN5O3 |
| Molecular Weight | 522.05 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | 3-[[4-[5-chloro-3-methyl-2-(1-piperidin-4-ylethoxy)phenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | Cc1cc(Cl)cc(-c2ncnn3cc(CN4C(=O)C5C(C4=O)C5(C)C)cc23)c1OC(C)C1CCNCC1 |
| InChI | InChI=1S/C28H32ClN5O3/c1-15-9-19(29)11-20(25(15)37-16(2)18-5-7-30-8-6-18)24-21-10-17(13-34(21)32-14-31-24)12-33-26(35)22-23(27(33)36)28(22,3)4/h9-11,13-14,16,18,22-23,30H,5-8,12H2,1-4H3 |
| InChIKey | WQLBHICHSKBOBK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.05 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|