C27H31ClN6O2 — CID 170961479
3-[[4-[5-chloro-3-methyl-2-(piperidin-3-ylmethylamino)phenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 170961479) has the molecular formula C27H31ClN6O2 and a molecular weight of 507.04 g/mol. Its IUPAC name is 3-[[4-[5-chloro-3-methyl-2-(piperidin-3-ylmethylamino)phenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | 3-[[4-[5-chloro-3-methyl-2-(piperidin-3-ylmethylamino)phenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 170961479 |
| Molecular Formula | C27H31ClN6O2 |
| Molecular Weight | 507.04 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 3-[[4-[5-chloro-3-methyl-2-(piperidin-3-ylmethylamino)phenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | Cc1cc(Cl)cc(-c2ncnn3cc(CN4C(=O)C5C(C4=O)C5(C)C)cc23)c1NCC1CCCNC1 |
| InChI | InChI=1S/C27H31ClN6O2/c1-15-7-18(28)9-19(23(15)30-11-16-5-4-6-29-10-16)24-20-8-17(13-34(20)32-14-31-24)12-33-25(35)21-22(26(33)36)27(21,2)3/h7-9,13-14,16,21-22,29-30H,4-6,10-12H2,1-3H3 |
| InChIKey | JHYYOYLLWAYHFG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 91.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.04 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|