C28H29Cl3F2N6O2 — CID 170961428
3-[[4-[5-chloro-1-[(5,5-difluoropiperidin-3-yl)methyl]indol-7-yl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione;dihydrochloride (PubChem CID 170961428) has the molecular formula C28H29Cl3F2N6O2 and a molecular weight of 625.94 g/mol. Its IUPAC name is 3-[[4-[5-chloro-1-[(5,5-difluoropiperidin-3-yl)methyl]indol-7-yl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione;dihydrochloride.
| Compound Name | 3-[[4-[5-chloro-1-[(5,5-difluoropiperidin-3-yl)methyl]indol-7-yl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione;dihydrochloride |
|---|---|
| PubChem CID | 170961428 |
| Molecular Formula | C28H29Cl3F2N6O2 |
| Molecular Weight | 625.94 g/mol |
| Exact Mass | 624.14 |
| IUPAC Name | 3-[[4-[5-chloro-1-[(5,5-difluoropiperidin-3-yl)methyl]indol-7-yl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione;dihydrochloride |
| SMILES | CC1(C)C2C(=O)N(Cc3cc4c(-c5cc(Cl)cc6ccn(CC7CNCC(F)(F)C7)c56)ncnn4c3)C(=O)C21.Cl.Cl |
| InChI | InChI=1S/C28H27ClF2N6O2.2ClH/c1-27(2)21-22(27)26(39)36(25(21)38)11-15-5-20-23(33-14-34-37(20)12-15)19-7-18(29)6-17-3-4-35(24(17)19)10-16-8-28(30,31)13-32-9-16;;/h3-7,12,14,16,21-22,32H,8-11,13H2,1-2H3;2*1H |
| InChIKey | JELQPNGHVMMYGW-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 84.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.94 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|