C27H26ClN7O3 — CID 174208335
2-[[4-[5-chloro-1-(morpholin-2-ylmethyl)indol-7-yl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,7-dihydro-4H-pyrrolo[1,2-a]pyrazine-1,3-dione (PubChem CID 174208335) has the molecular formula C27H26ClN7O3 and a molecular weight of 532.00 g/mol. Its IUPAC name is 2-[[4-[5-chloro-1-(morpholin-2-ylmethyl)indol-7-yl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,7-dihydro-4H-pyrrolo[1,2-a]pyrazine-1,3-dione.
| Compound Name | 2-[[4-[5-chloro-1-(morpholin-2-ylmethyl)indol-7-yl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,7-dihydro-4H-pyrrolo[1,2-a]pyrazine-1,3-dione |
|---|---|
| PubChem CID | 174208335 |
| Molecular Formula | C27H26ClN7O3 |
| Molecular Weight | 532.00 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | 2-[[4-[5-chloro-1-(morpholin-2-ylmethyl)indol-7-yl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,7-dihydro-4H-pyrrolo[1,2-a]pyrazine-1,3-dione |
| SMILES | O=C1CN2CCC=C2C(=O)N1Cc1cc2c(-c3cc(Cl)cc4ccn(CC5CNCCO5)c34)ncnn2c1 |
| InChI | InChI=1S/C27H26ClN7O3/c28-19-9-18-3-6-33(14-20-11-29-4-7-38-20)26(18)21(10-19)25-23-8-17(13-35(23)31-16-30-25)12-34-24(36)15-32-5-1-2-22(32)27(34)37/h2-3,6,8-10,13,16,20,29H,1,4-5,7,11-12,14-15H2 |
| InChIKey | OFNNJOMVZQPUTC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 97.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.00 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|