C28H25ClF3N7O5 — CID 174211843
[3-[[4-[5-chloro-1-[[(2S)-morpholin-2-yl]methyl]indazol-7-yl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-1-yl] 2,2,2-trifluoroacetate (PubChem CID 174211843) has the molecular formula C28H25ClF3N7O5 and a molecular weight of 632.00 g/mol. Its IUPAC name is [3-[[4-[5-chloro-1-[[(2S)-morpholin-2-yl]methyl]indazol-7-yl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [3-[[4-[5-chloro-1-[[(2S)-morpholin-2-yl]methyl]indazol-7-yl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 174211843 |
| Molecular Formula | C28H25ClF3N7O5 |
| Molecular Weight | 632.00 g/mol |
| Exact Mass | 631.16 |
| IUPAC Name | [3-[[4-[5-chloro-1-[[(2S)-morpholin-2-yl]methyl]indazol-7-yl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-1-yl] 2,2,2-trifluoroacetate |
| SMILES | CC1(C)C2C(=O)N(Cc3cc4c(-c5cc(Cl)cc6cnn(C[C@@H]7CNCCO7)c56)ncnn4c3)C(=O)C21OC(=O)C(F)(F)F |
| InChI | InChI=1S/C28H25ClF3N7O5/c1-26(2)22-23(40)37(24(41)27(22,26)44-25(42)28(30,31)32)10-14-5-19-20(34-13-36-38(19)11-14)18-7-16(29)6-15-8-35-39(21(15)18)12-17-9-33-3-4-43-17/h5-8,11,13,17,22,33H,3-4,9-10,12H2,1-2H3/t17-,22?,27?/m0/s1 |
| InChIKey | LZCDFKUEKHWUGC-USZVYGKESA-N |
| XLogP | 2.76 |
| TPSA | 132.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.00 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|