C31H31F3N6O7 — CID 174213111
methyl 7-[6-[(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-1-(morpholin-2-ylmethyl)indole-5-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 174213111) has the molecular formula C31H31F3N6O7 and a molecular weight of 656.62 g/mol. Its IUPAC name is methyl 7-[6-[(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-1-(morpholin-2-ylmethyl)indole-5-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl 7-[6-[(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-1-(morpholin-2-ylmethyl)indole-5-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 174213111 |
| Molecular Formula | C31H31F3N6O7 |
| Molecular Weight | 656.62 g/mol |
| Exact Mass | 656.22 |
| IUPAC Name | methyl 7-[6-[(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-1-(morpholin-2-ylmethyl)indole-5-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | COC(=O)c1cc(-c2ncnn3cc(CN4C(=O)C5C(C4=O)C5(C)C)cc23)c2c(ccn2CC2CNCCO2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C29H30N6O5.C2HF3O2/c1-29(2)22-23(29)27(37)34(26(22)36)12-16-8-21-24(31-15-32-35(21)13-16)20-10-18(28(38)39-3)9-17-4-6-33(25(17)20)14-19-11-30-5-7-40-19;3-2(4,5)1(6)7/h4,6,8-10,13,15,19,22-23,30H,5,7,11-12,14H2,1-3H3;(H,6,7) |
| InChIKey | SBYSBOYVNPONLQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 157.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.62 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|