C28H27F3N6O3 — CID 170961625
6,6-dimethyl-3-[[4-[1-[[(2S)-morpholin-2-yl]methyl]-5-(trifluoromethyl)indol-7-yl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-3-azabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 170961625) has the molecular formula C28H27F3N6O3 and a molecular weight of 552.56 g/mol. Its IUPAC name is 6,6-dimethyl-3-[[4-[1-[[(2S)-morpholin-2-yl]methyl]-5-(trifluoromethyl)indol-7-yl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-3-azabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | 6,6-dimethyl-3-[[4-[1-[[(2S)-morpholin-2-yl]methyl]-5-(trifluoromethyl)indol-7-yl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-3-azabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 170961625 |
| Molecular Formula | C28H27F3N6O3 |
| Molecular Weight | 552.56 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | 6,6-dimethyl-3-[[4-[1-[[(2S)-morpholin-2-yl]methyl]-5-(trifluoromethyl)indol-7-yl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-3-azabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | CC1(C)C2C(=O)N(Cc3cc4c(-c5cc(C(F)(F)F)cc6ccn(C[C@@H]7CNCCO7)c56)ncnn4c3)C(=O)C21 |
| InChI | InChI=1S/C28H27F3N6O3/c1-27(2)21-22(27)26(39)36(25(21)38)11-15-7-20-23(33-14-34-37(20)12-15)19-9-17(28(29,30)31)8-16-3-5-35(24(16)19)13-18-10-32-4-6-40-18/h3,5,7-9,12,14,18,21-22,32H,4,6,10-11,13H2,1-2H3/t18-,21?,22?/m0/s1 |
| InChIKey | CDRXJQAVAKTILV-XTWGIRIWSA-N |
| XLogP | 3.50 |
| TPSA | 93.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.56 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|