C28H28N6O5 — CID 174206958
7-[6-[(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-1-(morpholin-2-ylmethyl)indole-5-carboxylic acid (PubChem CID 174206958) has the molecular formula C28H28N6O5 and a molecular weight of 528.57 g/mol. Its IUPAC name is 7-[6-[(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-1-(morpholin-2-ylmethyl)indole-5-carboxylic acid.
| Compound Name | 7-[6-[(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-1-(morpholin-2-ylmethyl)indole-5-carboxylic acid |
|---|---|
| PubChem CID | 174206958 |
| Molecular Formula | C28H28N6O5 |
| Molecular Weight | 528.57 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | 7-[6-[(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-1-(morpholin-2-ylmethyl)indole-5-carboxylic acid |
| SMILES | CC1(C)C2C(=O)N(Cc3cc4c(-c5cc(C(=O)O)cc6ccn(CC7CNCCO7)c56)ncnn4c3)C(=O)C21 |
| InChI | InChI=1S/C28H28N6O5/c1-28(2)21-22(28)26(36)33(25(21)35)11-15-7-20-23(30-14-31-34(20)12-15)19-9-17(27(37)38)8-16-3-5-32(24(16)19)13-18-10-29-4-6-39-18/h3,5,7-9,12,14,18,21-22,29H,4,6,10-11,13H2,1-2H3,(H,37,38) |
| InChIKey | FBDDRPFPPUEVFK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 131.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.57 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|