C29H32N6O5 — CID 170961397
methyl 1-(morpholin-2-ylmethyl)-7-[6-[(3,3,4-trimethyl-2,5-dioxopyrrolidin-1-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]indole-5-carboxylate (PubChem CID 170961397) has the molecular formula C29H32N6O5 and a molecular weight of 544.61 g/mol. Its IUPAC name is methyl 1-(morpholin-2-ylmethyl)-7-[6-[(3,3,4-trimethyl-2,5-dioxopyrrolidin-1-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]indole-5-carboxylate.
| Compound Name | methyl 1-(morpholin-2-ylmethyl)-7-[6-[(3,3,4-trimethyl-2,5-dioxopyrrolidin-1-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]indole-5-carboxylate |
|---|---|
| PubChem CID | 170961397 |
| Molecular Formula | C29H32N6O5 |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | methyl 1-(morpholin-2-ylmethyl)-7-[6-[(3,3,4-trimethyl-2,5-dioxopyrrolidin-1-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]indole-5-carboxylate |
| SMILES | COC(=O)c1cc(-c2ncnn3cc(CN4C(=O)C(C)C(C)(C)C4=O)cc23)c2c(ccn2CC2CNCCO2)c1 |
| InChI | InChI=1S/C29H32N6O5/c1-17-26(36)34(28(38)29(17,2)3)13-18-9-23-24(31-16-32-35(23)14-18)22-11-20(27(37)39-4)10-19-5-7-33(25(19)22)15-21-12-30-6-8-40-21/h5,7,9-11,14,16-17,21,30H,6,8,12-13,15H2,1-4H3 |
| InChIKey | PETIDEIBDFQESK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 120.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|