C27H28Cl2N6O5 — CID 170961531
tert-butyl 2-[[2,4-dichloro-6-[6-[(2,4-dioxo-1H-pyrimidin-3-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]phenyl]methyl]morpholine-4-carboxylate (PubChem CID 170961531) has the molecular formula C27H28Cl2N6O5 and a molecular weight of 587.46 g/mol. Its IUPAC name is tert-butyl 2-[[2,4-dichloro-6-[6-[(2,4-dioxo-1H-pyrimidin-3-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]phenyl]methyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 2-[[2,4-dichloro-6-[6-[(2,4-dioxo-1H-pyrimidin-3-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]phenyl]methyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 170961531 |
| Molecular Formula | C27H28Cl2N6O5 |
| Molecular Weight | 587.46 g/mol |
| Exact Mass | 586.15 |
| IUPAC Name | tert-butyl 2-[[2,4-dichloro-6-[6-[(2,4-dioxo-1H-pyrimidin-3-yl)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]phenyl]methyl]morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOC(Cc2c(Cl)cc(Cl)cc2-c2ncnn3cc(Cn4c(=O)cc[nH]c4=O)cc23)C1 |
| InChI | InChI=1S/C27H28Cl2N6O5/c1-27(2,3)40-26(38)33-6-7-39-18(14-33)11-19-20(9-17(28)10-21(19)29)24-22-8-16(13-35(22)32-15-31-24)12-34-23(36)4-5-30-25(34)37/h4-5,8-10,13,15,18H,6-7,11-12,14H2,1-3H3,(H,30,37) |
| InChIKey | VBMGCZANCFUPOI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 123.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |