C20H29BClNO5 — CID 174212964
(6S)-2-[[4-chloro-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-6-methylmorpholine-4-carboxylic acid (PubChem CID 174212964) has the molecular formula C20H29BClNO5 and a molecular weight of 409.72 g/mol. Its IUPAC name is (6S)-2-[[4-chloro-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-6-methylmorpholine-4-carboxylic acid.
| Compound Name | (6S)-2-[[4-chloro-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-6-methylmorpholine-4-carboxylic acid |
|---|---|
| PubChem CID | 174212964 |
| Molecular Formula | C20H29BClNO5 |
| Molecular Weight | 409.72 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | (6S)-2-[[4-chloro-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-6-methylmorpholine-4-carboxylic acid |
| SMILES | Cc1cc(Cl)cc(B2OC(C)(C)C(C)(C)O2)c1CC1CN(C(=O)O)C[C@H](C)O1 |
| InChI | InChI=1S/C20H29BClNO5/c1-12-7-14(22)8-17(21-27-19(3,4)20(5,6)28-21)16(12)9-15-11-23(18(24)25)10-13(2)26-15/h7-8,13,15H,9-11H2,1-6H3,(H,24,25)/t13-,15?/m0/s1 |
| InChIKey | OXYKTXDHBSZKSB-CFMCSPIPSA-N |
| XLogP | 3.26 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.72 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|