C19H25BClF2NO5 — CID 174208453
(5S)-5-[4-chloro-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-3,3-difluoropiperidine-1-carboxylic acid (PubChem CID 174208453) has the molecular formula C19H25BClF2NO5 and a molecular weight of 431.67 g/mol. Its IUPAC name is (5S)-5-[4-chloro-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-3,3-difluoropiperidine-1-carboxylic acid.
| Compound Name | (5S)-5-[4-chloro-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-3,3-difluoropiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 174208453 |
| Molecular Formula | C19H25BClF2NO5 |
| Molecular Weight | 431.67 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | (5S)-5-[4-chloro-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-3,3-difluoropiperidine-1-carboxylic acid |
| SMILES | Cc1cc(Cl)cc(B2OC(C)(C)C(C)(C)O2)c1O[C@@H]1CN(C(=O)O)CC(F)(F)C1 |
| InChI | InChI=1S/C19H25BClF2NO5/c1-11-6-12(21)7-14(20-28-17(2,3)18(4,5)29-20)15(11)27-13-8-19(22,23)10-24(9-13)16(25)26/h6-7,13H,8-10H2,1-5H3,(H,25,26)/t13-/m0/s1 |
| InChIKey | IHQSEVGOOMNZLW-ZDUSSCGKSA-N |
| XLogP | 3.71 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.67 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|