About 2,3-diphenyltetrazol-2-ium chloride
2,3-diphenyltetrazol-2-ium chloride (PubChem CID 15115083) has the molecular formula C13H11ClN4
and a molecular weight of 258.71 g/mol. Its IUPAC name is 2,3-diphenyltetrazol-2-ium chloride.
Molecular Properties
| Compound Name | 2,3-diphenyltetrazol-2-ium chloride |
| PubChem CID | 15115083 |
| Molecular Formula | C13H11ClN4 |
| Molecular Weight | 258.71 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 2,3-diphenyltetrazol-2-ium chloride |
| SMILES | [Cl-].c1ccc(-n2ncn[n+]2-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H11N4.ClH/c1-3-7-12(8-4-1)16-14-11-15-17(16)13-9-5-2-6-10-13;/h1-11H;1H/q+1;/p-1 |
| InChIKey | AGMLMLIUHGMNTA-UHFFFAOYSA-M |
| XLogP | -1.45 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.71 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2,3-diphenyltetrazol-2-ium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diphenyltetrazol-2-ium chloride?
The IUPAC name of 2,3-diphenyltetrazol-2-ium chloride (CID 15115083) is 2,3-diphenyltetrazol-2-ium chloride.
What is the SMILES notation for 2,3-diphenyltetrazol-2-ium chloride?
The canonical SMILES for 2,3-diphenyltetrazol-2-ium chloride is [Cl-].c1ccc(-n2ncn[n+]2-c2ccccc2)cc1.
What is the InChIKey of 2,3-diphenyltetrazol-2-ium chloride?
The InChIKey is AGMLMLIUHGMNTA-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H11N4.ClH/c1-3-7-12(8-4-1)16-14-11-15-17(16)13-9-5-2-6-10-13;/h1-11H;1H/q+1;/p-1.
What are the key properties of 2,3-diphenyltetrazol-2-ium chloride?
2,3-diphenyltetrazol-2-ium chloride has a molecular weight of 258.71 g/mol, XLogP of -1.45, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diphenyltetrazol-2-ium chloride is sourced from PubChem (CID 15115083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).