C14H13ClN4 — CID 13010650
5-methyl-2,3-diphenyltetrazol-2-ium chloride (PubChem CID 13010650) has the molecular formula C14H13ClN4 and a molecular weight of 272.74 g/mol. Its IUPAC name is 5-methyl-2,3-diphenyltetrazol-2-ium chloride.
| Compound Name | 5-methyl-2,3-diphenyltetrazol-2-ium chloride |
|---|---|
| PubChem CID | 13010650 |
| Molecular Formula | C14H13ClN4 |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 5-methyl-2,3-diphenyltetrazol-2-ium chloride |
| SMILES | Cc1nn(-c2ccccc2)[n+](-c2ccccc2)n1.[Cl-] |
| InChI | InChI=1S/C14H13N4.ClH/c1-12-15-17(13-8-4-2-5-9-13)18(16-12)14-10-6-3-7-11-14;/h2-11H,1H3;1H/q+1;/p-1 |
| InChIKey | DNLGEYNSADNPQS-UHFFFAOYSA-M |
| XLogP | -1.14 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|