C19H17ClN4O — CID 23288416
2,3,5-triphenyltetrazol-2-ium;chloride;hydrate (PubChem CID 23288416) has the molecular formula C19H17ClN4O and a molecular weight of 352.83 g/mol. Its IUPAC name is 2,3,5-triphenyltetrazol-2-ium;chloride;hydrate.
| Compound Name | 2,3,5-triphenyltetrazol-2-ium;chloride;hydrate |
|---|---|
| PubChem CID | 23288416 |
| Molecular Formula | C19H17ClN4O |
| Molecular Weight | 352.83 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 2,3,5-triphenyltetrazol-2-ium;chloride;hydrate |
| SMILES | O.[Cl-].c1ccc(-c2nn(-c3ccccc3)[n+](-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C19H15N4.ClH.H2O/c1-4-10-16(11-5-1)19-20-22(17-12-6-2-7-13-17)23(21-19)18-14-8-3-9-15-18;;/h1-15H;1H;1H2/q+1;;/p-1 |
| InChIKey | LJVSLFRHFMUIDK-UHFFFAOYSA-M |
| XLogP | -0.61 |
| TPSA | 66.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.83 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|