C20H16N5O+ — CID 155701941
2-(4-methylphenyl)-3-(4-nitrosophenyl)-5-phenyltetrazol-2-ium (PubChem CID 155701941) has the molecular formula C20H16N5O+ and a molecular weight of 342.38 g/mol. Its IUPAC name is 2-(4-methylphenyl)-3-(4-nitrosophenyl)-5-phenyltetrazol-2-ium.
| Compound Name | 2-(4-methylphenyl)-3-(4-nitrosophenyl)-5-phenyltetrazol-2-ium |
|---|---|
| PubChem CID | 155701941 |
| Molecular Formula | C20H16N5O+ |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 2-(4-methylphenyl)-3-(4-nitrosophenyl)-5-phenyltetrazol-2-ium |
| SMILES | Cc1ccc(-[n+]2nc(-c3ccccc3)nn2-c2ccc(N=O)cc2)cc1 |
| InChI | InChI=1S/C20H16N5O/c1-15-7-11-18(12-8-15)24-21-20(16-5-3-2-4-6-16)22-25(24)19-13-9-17(23-26)10-14-19/h2-14H,1H3/q+1 |
| InChIKey | QRBCPAYMOFOUEZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 64.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|